About (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one
(3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one (PubChem CID 86709201) has the molecular formula C18H18F3NO
and a molecular weight of 321.34 g/mol. Its IUPAC name is (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one.
Molecular Properties
| Compound Name | (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one |
| PubChem CID | 86709201 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one |
| SMILES | C[C@H](C(=O)C(F)(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H18F3NO/c1-14(17(23)18(19,20)21)22(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | UINICFNJBGQAAF-CQSZACIVSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one?
The IUPAC name of (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one (CID 86709201) is (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one.
What is the SMILES notation for (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one?
The canonical SMILES for (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one is C[C@H](C(=O)C(F)(F)F)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one?
The InChIKey is UINICFNJBGQAAF-CQSZACIVSA-N. The full InChI is InChI=1S/C18H18F3NO/c1-14(17(23)18(19,20)21)22(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3/t14-/m1/s1.
What are the key properties of (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one?
(3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one has a molecular weight of 321.34 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(dibenzylamino)-1,1,1-trifluorobutan-2-one is sourced from PubChem (CID 86709201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).