(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate

C7H7F3O5S — CID 86709473

IUPAC(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate
SMILESCC1=C(OS(=O)(=O)C(F)(F)F)C(C)OC1=O
InChIInChI=1S/C7H7F3O5S/c1-3-5(4(2)14-6(3)11)15-16(12,13)7(8,9)10/h4H,1-2H3
InChIKeyJGRFHZPYIZKMIR-UHFFFAOYSA-N
MW260.19 g/mol
LogP1.07
Rot. Bonds2

About (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate

(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate (PubChem CID 86709473) has the molecular formula C7H7F3O5S and a molecular weight of 260.19 g/mol. Its IUPAC name is (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate
PubChem CID86709473
Molecular FormulaC7H7F3O5S
Molecular Weight260.19 g/mol
Exact Mass260.00
IUPAC Name(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate
SMILESCC1=C(OS(=O)(=O)C(F)(F)F)C(C)OC1=O
InChIInChI=1S/C7H7F3O5S/c1-3-5(4(2)14-6(3)11)15-16(12,13)7(8,9)10/h4H,1-2H3
InChIKeyJGRFHZPYIZKMIR-UHFFFAOYSA-N
XLogP1.07
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.19
LogP ≤ 51.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate?
The IUPAC name of (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate (CID 86709473) is (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate?
The canonical SMILES for (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate is CC1=C(OS(=O)(=O)C(F)(F)F)C(C)OC1=O.
What is the InChIKey of (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate?
The InChIKey is JGRFHZPYIZKMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3O5S/c1-3-5(4(2)14-6(3)11)15-16(12,13)7(8,9)10/h4H,1-2H3.
What are the key properties of (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate?
(2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate has a molecular weight of 260.19 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-5-oxo-2H-furan-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 86709473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).