About methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride
methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride (PubChem CID 86709705) has the molecular formula C18H23ClN2O2
and a molecular weight of 334.85 g/mol. Its IUPAC name is methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride |
| PubChem CID | 86709705 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)/C=C/c1ccc2ccc([C@@H](C)N)nc2c1.Cl |
| InChI | InChI=1S/C18H22N2O2.ClH/c1-12(19)15-8-7-14-6-5-13(11-16(14)20-15)9-10-18(2,3)17(21)22-4;/h5-12H,19H2,1-4H3;1H/b10-9+;/t12-;/m1./s1 |
| InChIKey | BCOCTHFZVATXDD-ZMOHHVQKSA-N |
| XLogP | 3.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride?
The IUPAC name of methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride (CID 86709705) is methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride.
What is the SMILES notation for methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride?
The canonical SMILES for methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride is COC(=O)C(C)(C)/C=C/c1ccc2ccc([C@@H](C)N)nc2c1.Cl.
What is the InChIKey of methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride?
The InChIKey is BCOCTHFZVATXDD-ZMOHHVQKSA-N. The full InChI is InChI=1S/C18H22N2O2.ClH/c1-12(19)15-8-7-14-6-5-13(11-16(14)20-15)9-10-18(2,3)17(21)22-4;/h5-12H,19H2,1-4H3;1H/b10-9+;/t12-;/m1./s1.
What are the key properties of methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride?
methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride has a molecular weight of 334.85 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[2-[(1R)-1-aminoethyl]quinolin-7-yl]-2,2-dimethylbut-3-enoate;hydrochloride is sourced from PubChem (CID 86709705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).