About propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate
propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate (PubChem CID 86709878) has the molecular formula C15H12ClF2NO2
and a molecular weight of 311.72 g/mol. Its IUPAC name is propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate |
| PubChem CID | 86709878 |
| Molecular Formula | C15H12ClF2NO2 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate |
| SMILES | CC(C)OC(=O)c1cc(F)c(F)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H12ClF2NO2/c1-8(2)21-15(20)12-7-11(17)13(18)14(19-12)9-3-5-10(16)6-4-9/h3-8H,1-2H3 |
| InChIKey | FWPXDYCSECBKSZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate?
The IUPAC name of propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate (CID 86709878) is propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate.
What is the SMILES notation for propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate?
The canonical SMILES for propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate is CC(C)OC(=O)c1cc(F)c(F)c(-c2ccc(Cl)cc2)n1.
What is the InChIKey of propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate?
The InChIKey is FWPXDYCSECBKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2NO2/c1-8(2)21-15(20)12-7-11(17)13(18)14(19-12)9-3-5-10(16)6-4-9/h3-8H,1-2H3.
What are the key properties of propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate?
propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate has a molecular weight of 311.72 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-(4-chlorophenyl)-4,5-difluoropyridine-2-carboxylate is sourced from PubChem (CID 86709878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).