C27H20F4N4O3S2 — CID 86710000
[(4aR)-1-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 86710000) has the molecular formula C27H20F4N4O3S2 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 86710000 |
| Molecular Formula | C27H20F4N4O3S2 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C27H20F4N4O3S2/c28-20-4-6-21(7-5-20)35-23-13-18-8-10-34(40(37,38)22-3-1-2-19(12-22)27(29,30)31)16-26(18,14-17(23)15-33-35)24(36)25-32-9-11-39-25/h1-7,9,11-13,15H,8,10,14,16H2/t26-/m0/s1 |
| InChIKey | PMNNBWCESVXEDP-SANMLTNESA-N |
| XLogP | 5.39 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |