C32H33N3O5 — CID 86710376
2-[(2S)-1-[9-(1-ethoxyethenyl)-4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxy-4-methylpentan-2-yl]isoindole-1,3-dione (PubChem CID 86710376) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[(2S)-1-[9-(1-ethoxyethenyl)-4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxy-4-methylpentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-[9-(1-ethoxyethenyl)-4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxy-4-methylpentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86710376 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[(2S)-1-[9-(1-ethoxyethenyl)-4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxy-4-methylpentan-2-yl]isoindole-1,3-dione |
| SMILES | C=C(OCC)c1cc2c3ccnc(C)c3c(=O)n(C)c2cc1OC[C@H](CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H33N3O5/c1-7-39-20(5)25-15-26-22-12-13-33-19(4)29(22)32(38)34(6)27(26)16-28(25)40-17-21(14-18(2)3)35-30(36)23-10-8-9-11-24(23)31(35)37/h8-13,15-16,18,21H,5,7,14,17H2,1-4,6H3/t21-/m0/s1 |
| InChIKey | SIJVZEQMIPRLGR-NRFANRHFSA-N |
| XLogP | 5.49 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|