C22H29F3N4O4S — CID 86710574
[3-methoxy-4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenyl] trifluoromethanesulfonate (PubChem CID 86710574) has the molecular formula C22H29F3N4O4S and a molecular weight of 502.56 g/mol. Its IUPAC name is [3-methoxy-4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-methoxy-4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86710574 |
| Molecular Formula | C22H29F3N4O4S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [3-methoxy-4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1ccc(N(C)C2CC(C)(C)NC(C)(C)C2)nn1 |
| InChI | InChI=1S/C22H29F3N4O4S/c1-20(2)12-14(13-21(3,4)28-20)29(5)19-10-9-17(26-27-19)16-8-7-15(11-18(16)32-6)33-34(30,31)22(23,24)25/h7-11,14,28H,12-13H2,1-6H3 |
| InChIKey | XBBXUQXQMUCNNJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|