C22H26F6N4O4S — CID 86710620
[4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate (PubChem CID 86710620) has the molecular formula C22H26F6N4O4S and a molecular weight of 556.53 g/mol. Its IUPAC name is [4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86710620 |
| Molecular Formula | C22H26F6N4O4S |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | [4-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate |
| SMILES | CN(c1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2OC(F)(F)F)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H26F6N4O4S/c1-19(2)11-13(12-20(3,4)31-19)32(5)18-9-8-16(29-30-18)15-7-6-14(10-17(15)35-21(23,24)25)36-37(33,34)22(26,27)28/h6-10,13,31H,11-12H2,1-5H3 |
| InChIKey | ACAGFLBCLYSTJA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|