About ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate
ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (PubChem CID 86711090) has the molecular formula C24H43NO7
and a molecular weight of 457.61 g/mol. Its IUPAC name is ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
Molecular Properties
| Compound Name | ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| PubChem CID | 86711090 |
| Molecular Formula | C24H43NO7 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| SMILES | CC(=O)NC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43NO7/c1-17(26)25-24(14-11-18(27)30-21(2,3)4,15-12-19(28)31-22(5,6)7)16-13-20(29)32-23(8,9)10/h11-16H2,1-10H3,(H,25,26) |
| InChIKey | GNEPBDTZHNPWKZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The IUPAC name of ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (CID 86711090) is ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
What is the SMILES notation for ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The canonical SMILES for ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate is CC(=O)NC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)CCC(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The InChIKey is GNEPBDTZHNPWKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H43NO7/c1-17(26)25-24(14-11-18(27)30-21(2,3)4,15-12-19(28)31-22(5,6)7)16-13-20(29)32-23(8,9)10/h11-16H2,1-10H3,(H,25,26).
What are the key properties of ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate has a molecular weight of 457.61 g/mol, XLogP of 4.23, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-acetamido-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate is sourced from PubChem (CID 86711090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).