C17H29ClN2O2Si — CID 86711135
9-[tert-butyl(dimethyl)silyl]oxy-3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 86711135) has the molecular formula C17H29ClN2O2Si and a molecular weight of 356.97 g/mol. Its IUPAC name is 9-[tert-butyl(dimethyl)silyl]oxy-3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-[tert-butyl(dimethyl)silyl]oxy-3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 86711135 |
| Molecular Formula | C17H29ClN2O2Si |
| Molecular Weight | 356.97 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 9-[tert-butyl(dimethyl)silyl]oxy-3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCCl)CCCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29ClN2O2Si/c1-12-13(9-10-18)16(21)20-11-7-8-14(15(20)19-12)22-23(5,6)17(2,3)4/h14H,7-11H2,1-6H3 |
| InChIKey | RFFRVXTWIIJWQD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.97 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|