About 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol
2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol (PubChem CID 86711178) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol |
| PubChem CID | 86711178 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol |
| SMILES | OCC[C@@H]1C[C@@H]1C1CCNCC1 |
| InChI | InChI=1S/C10H19NO/c12-6-3-9-7-10(9)8-1-4-11-5-2-8/h8-12H,1-7H2/t9-,10-/m1/s1 |
| InChIKey | VYNIUPMZSJSTBI-NXEZZACHSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol?
The IUPAC name of 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol (CID 86711178) is 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol.
What is the SMILES notation for 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol?
The canonical SMILES for 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol is OCC[C@@H]1C[C@@H]1C1CCNCC1.
What is the InChIKey of 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol?
The InChIKey is VYNIUPMZSJSTBI-NXEZZACHSA-N. The full InChI is InChI=1S/C10H19NO/c12-6-3-9-7-10(9)8-1-4-11-5-2-8/h8-12H,1-7H2/t9-,10-/m1/s1.
What are the key properties of 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol?
2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol has a molecular weight of 169.27 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-piperidin-4-ylcyclopropyl]ethanol is sourced from PubChem (CID 86711178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).