About 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide
2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide (PubChem CID 86712307) has the molecular formula C15H15Cl2N3O
and a molecular weight of 324.21 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide.
Molecular Properties
| Compound Name | 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide |
| PubChem CID | 86712307 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide |
| SMILES | CC(C(N)=O)c1ccccc1CCc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O/c1-9(14(18)21)11-5-3-2-4-10(11)6-7-13-12(16)8-19-15(17)20-13/h2-5,8-9H,6-7H2,1H3,(H2,18,21) |
| InChIKey | YWVFNEJAHCAGQD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide?
The IUPAC name of 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide (CID 86712307) is 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide.
What is the SMILES notation for 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide?
The canonical SMILES for 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide is CC(C(N)=O)c1ccccc1CCc1nc(Cl)ncc1Cl.
What is the InChIKey of 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide?
The InChIKey is YWVFNEJAHCAGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N3O/c1-9(14(18)21)11-5-3-2-4-10(11)6-7-13-12(16)8-19-15(17)20-13/h2-5,8-9H,6-7H2,1H3,(H2,18,21).
What are the key properties of 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide?
2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide has a molecular weight of 324.21 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,5-dichloropyrimidin-4-yl)ethyl]phenyl]propanamide is sourced from PubChem (CID 86712307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).