C47H50F4O9S2 — CID 86712474
2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate;1,1,2,2-tetrafluoro-3-[2-(3-hydroxy-1-adamantyl)acetyl]oxybutane-1-sulfonate (PubChem CID 86712474) has the molecular formula C47H50F4O9S2 and a molecular weight of 899.03 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate;1,1,2,2-tetrafluoro-3-[2-(3-hydroxy-1-adamantyl)acetyl]oxybutane-1-sulfonate.
| Compound Name | 2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate;1,1,2,2-tetrafluoro-3-[2-(3-hydroxy-1-adamantyl)acetyl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 86712474 |
| Molecular Formula | C47H50F4O9S2 |
| Molecular Weight | 899.03 g/mol |
| Exact Mass | 898.28 |
| IUPAC Name | 2-phenylpropan-2-yl 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylphenoxy)acetate;1,1,2,2-tetrafluoro-3-[2-(3-hydroxy-1-adamantyl)acetyl]oxybutane-1-sulfonate |
| SMILES | CC(OC(=O)CC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)C(F)(F)S(=O)(=O)[O-].Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1OCC(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H29O3S.C16H22F4O6S/c1-21-18-24(35-27-16-10-8-14-25(27)26-15-9-11-17-28(26)35)19-22(2)30(21)33-20-29(32)34-31(3,4)23-12-6-5-7-13-23;1-9(15(17,18)16(19,20)27(23,24)25)26-12(21)7-13-3-10-2-11(4-13)6-14(22,5-10)8-13/h5-19H,20H2,1-4H3;9-11,22H,2-8H2,1H3,(H,23,24,25)/q+1;/p-1 |
| InChIKey | PJXZFXJSTZYPAZ-UHFFFAOYSA-M |
| XLogP | 10.62 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.03 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|