About 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine
2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine (PubChem CID 86712779) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine.
Molecular Properties
| Compound Name | 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine |
| PubChem CID | 86712779 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine |
| SMILES | NCCN1CCC2(CC2)c2ccccc21 |
| InChI | InChI=1S/C13H18N2/c14-8-10-15-9-7-13(5-6-13)11-3-1-2-4-12(11)15/h1-4H,5-10,14H2 |
| InChIKey | BFFLNSGPORPYEG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine?
The IUPAC name of 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine (CID 86712779) is 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine.
What is the SMILES notation for 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine?
The canonical SMILES for 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine is NCCN1CCC2(CC2)c2ccccc21.
What is the InChIKey of 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine?
The InChIKey is BFFLNSGPORPYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c14-8-10-15-9-7-13(5-6-13)11-3-1-2-4-12(11)15/h1-4H,5-10,14H2.
What are the key properties of 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine?
2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine has a molecular weight of 202.30 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-ylethanamine is sourced from PubChem (CID 86712779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).