C13H16F5N5O3 — CID 86712989
N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 86712989) has the molecular formula C13H16F5N5O3 and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86712989 |
| Molecular Formula | C13H16F5N5O3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@@H]1CCCN(c2c([N+](=O)[O-])cnn2CC(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H16F5N5O3/c14-10(15)7-22-11(9(6-19-22)23(25)26)21-4-1-2-8(3-5-21)20-12(24)13(16,17)18/h6,8,10H,1-5,7H2,(H,20,24)/t8-/m1/s1 |
| InChIKey | OMVCMIWASAMINP-MRVPVSSYSA-N |
| XLogP | 2.09 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|