C13H18F3N5O4 — CID 86713001
2,2,2-trifluoro-N-[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide (PubChem CID 86713001) has the molecular formula C13H18F3N5O4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 86713001 |
| Molecular Formula | C13H18F3N5O4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-hydroxy-4-methyl-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(O)C(C)(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F3N5O4/c1-12(18-11(23)13(14,15)16)4-6-20(5-3-9(12)22)10-8(21(24)25)7-17-19(10)2/h7,9,22H,3-6H2,1-2H3,(H,18,23) |
| InChIKey | UGZDCFNVFVSGHU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|