C11H8Cl3FN2O5 — CID 86713124
2,2,2-trichloroethyl 2-[(3-fluoro-4-nitrobenzoyl)amino]acetate (PubChem CID 86713124) has the molecular formula C11H8Cl3FN2O5 and a molecular weight of 373.55 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(3-fluoro-4-nitrobenzoyl)amino]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[(3-fluoro-4-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 86713124 |
| Molecular Formula | C11H8Cl3FN2O5 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(3-fluoro-4-nitrobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc([N+](=O)[O-])c(F)c1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl3FN2O5/c12-11(13,14)5-22-9(18)4-16-10(19)6-1-2-8(17(20)21)7(15)3-6/h1-3H,4-5H2,(H,16,19) |
| InChIKey | IMPBCYKFGZHSSZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|