C17H11BrFN5S — CID 86713200
2-[5-(6-bromo-2-pyridinyl)-2-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-1,3-thiazole (PubChem CID 86713200) has the molecular formula C17H11BrFN5S and a molecular weight of 416.28 g/mol. Its IUPAC name is 2-[5-(6-bromo-2-pyridinyl)-2-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-1,3-thiazole.
| Compound Name | 2-[5-(6-bromo-2-pyridinyl)-2-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 86713200 |
| Molecular Formula | C17H11BrFN5S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-[5-(6-bromo-2-pyridinyl)-2-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-1,3-thiazole |
| SMILES | Fc1ccccc1Cn1nc(-c2cccc(Br)n2)nc1-c1nccs1 |
| InChI | InChI=1S/C17H11BrFN5S/c18-14-7-3-6-13(21-14)15-22-16(17-20-8-9-25-17)24(23-15)10-11-4-1-2-5-12(11)19/h1-9H,10H2 |
| InChIKey | PXHLUTCAQNZTMP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|