C27H27NO5 — CID 86713212
(1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-(oxolan-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 86713212) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-(oxolan-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-(oxolan-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 86713212 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-(oxolan-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(OCC2CCCO2)ccc1/C=C/C(=O)CC(=O)/C=C/c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C27H27NO5/c1-31-27-17-24(33-18-25-3-2-14-32-25)11-8-21(27)7-10-23(30)16-22(29)9-5-19-4-6-20-12-13-28-26(20)15-19/h4-13,15,17,25,28H,2-3,14,16,18H2,1H3/b9-5+,10-7+ |
| InChIKey | RTQXVDGQEZRUPW-FWMCCXIMSA-N |
| XLogP | 4.99 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|