C21H24FIN6O4 — CID 86713737
tert-butyl N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]carbamate (PubChem CID 86713737) has the molecular formula C21H24FIN6O4 and a molecular weight of 570.36 g/mol. Its IUPAC name is tert-butyl N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]carbamate |
|---|---|
| PubChem CID | 86713737 |
| Molecular Formula | C21H24FIN6O4 |
| Molecular Weight | 570.36 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | tert-butyl N-[3-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1c(Cc2cc3c(cc2I)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C21H24FIN6O4/c1-21(2,3)33-20(30)25-5-4-6-29-15(26-16-17(24)27-19(22)28-18(16)29)8-11-7-13-14(9-12(11)23)32-10-31-13/h7,9H,4-6,8,10H2,1-3H3,(H,25,30)(H2,24,27,28) |
| InChIKey | HCNSQKUVAJGTQW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|