About 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine
3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 86713994) has the molecular formula C12H33NO3Si3
and a molecular weight of 323.66 g/mol. Its IUPAC name is 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| PubChem CID | 86713994 |
| Molecular Formula | C12H33NO3Si3 |
| Molecular Weight | 323.66 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CO[Si](CCCN([Si](C)(C)C)[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C12H33NO3Si3/c1-14-19(15-2,16-3)12-10-11-13(17(4,5)6)18(7,8)9/h10-12H2,1-9H3 |
| InChIKey | JOGZENPUTBJZBI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The IUPAC name of 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine (CID 86713994) is 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine.
What is the SMILES notation for 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The canonical SMILES for 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine is CO[Si](CCCN([Si](C)(C)C)[Si](C)(C)C)(OC)OC.
What is the InChIKey of 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
The InChIKey is JOGZENPUTBJZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H33NO3Si3/c1-14-19(15-2,16-3)12-10-11-13(17(4,5)6)18(7,8)9/h10-12H2,1-9H3.
What are the key properties of 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine?
3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine has a molecular weight of 323.66 g/mol, XLogP of 3.23, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethoxysilyl-N,N-bis(trimethylsilyl)propan-1-amine is sourced from PubChem (CID 86713994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).