About dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate
dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate (PubChem CID 86714155) has the molecular formula C13H16N2O4S
and a molecular weight of 296.35 g/mol. Its IUPAC name is dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate |
| PubChem CID | 86714155 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate |
| SMILES | COC(=O)C=CC(C(=O)OC)=C(C)NCc1nccs1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9(15-8-11-14-6-7-20-11)10(13(17)19-3)4-5-12(16)18-2/h4-7,15H,8H2,1-3H3 |
| InChIKey | ZALFEQHFAJOTBH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate?
The IUPAC name of dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate (CID 86714155) is dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate.
What is the SMILES notation for dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate?
The canonical SMILES for dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate is COC(=O)C=CC(C(=O)OC)=C(C)NCc1nccs1.
What is the InChIKey of dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate?
The InChIKey is ZALFEQHFAJOTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4S/c1-9(15-8-11-14-6-7-20-11)10(13(17)19-3)4-5-12(16)18-2/h4-7,15H,8H2,1-3H3.
What are the key properties of dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate?
dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate has a molecular weight of 296.35 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-[1-(1,3-thiazol-2-ylmethylamino)ethylidene]pent-2-enedioate is sourced from PubChem (CID 86714155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).