C25H27ClF3N5O3 — CID 86714222
tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)-1,5-naphthyridin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 86714222) has the molecular formula C25H27ClF3N5O3 and a molecular weight of 537.97 g/mol. Its IUPAC name is tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)-1,5-naphthyridin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)-1,5-naphthyridin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86714222 |
| Molecular Formula | C25H27ClF3N5O3 |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | tert-butyl 4-[4-[[6-chloro-3-(hydroxymethyl)-1,5-naphthyridin-4-yl]amino]-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3c(CO)cnc4ccc(Cl)nc34)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H27ClF3N5O3/c1-24(2,3)37-23(36)34-10-8-33(9-11-34)19-6-4-16(12-17(19)25(27,28)29)31-21-15(14-35)13-30-18-5-7-20(26)32-22(18)21/h4-7,12-13,35H,8-11,14H2,1-3H3,(H,30,31) |
| InChIKey | GFKWAZZGOUMXKR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|