C31H50N2O3 — CID 86714327
tert-butyl 4-[[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 86714327) has the molecular formula C31H50N2O3 and a molecular weight of 498.75 g/mol. Its IUPAC name is tert-butyl 4-[[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86714327 |
| Molecular Formula | C31H50N2O3 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.38 |
| IUPAC Name | tert-butyl 4-[[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H50N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(34)32-27-28-23-25-33(26-24-28)30(35)36-31(2,3)4/h6-7,9-10,12-13,15-16,18-19,28H,5,8,11,14,17,20-27H2,1-4H3,(H,32,34)/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | PDCNIMDCCSBMON-WMPRHZDHSA-N |
| XLogP | 7.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|