C20H22N2O2S — CID 86714429
1-(cyclohexylmethyl)-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxylic acid (PubChem CID 86714429) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-(cyclohexylmethyl)-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 86714429 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(Cc1cccs1)n2CC1CCCCC1 |
| InChI | InChI=1S/C20H22N2O2S/c23-20(24)15-8-9-18-17(11-15)21-19(12-16-7-4-10-25-16)22(18)13-14-5-2-1-3-6-14/h4,7-11,14H,1-3,5-6,12-13H2,(H,23,24) |
| InChIKey | LETSMOIJEVXVRK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |