About (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine
(E)-N,N-bis(2-methylpropyl)but-1-en-1-amine (PubChem CID 86714715) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine |
| PubChem CID | 86714715 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine |
| SMILES | CC/C=C/N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C12H25N/c1-6-7-8-13(9-11(2)3)10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7+ |
| InChIKey | CFXVYUTXMBQOBF-BQYQJAHWSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine?
The IUPAC name of (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine (CID 86714715) is (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine.
What is the SMILES notation for (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine?
The canonical SMILES for (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine is CC/C=C/N(CC(C)C)CC(C)C.
What is the InChIKey of (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine?
The InChIKey is CFXVYUTXMBQOBF-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H25N/c1-6-7-8-13(9-11(2)3)10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7+.
What are the key properties of (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine?
(E)-N,N-bis(2-methylpropyl)but-1-en-1-amine has a molecular weight of 183.34 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(2-methylpropyl)but-1-en-1-amine is sourced from PubChem (CID 86714715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).