C14H19ClFN3O2 — CID 86714739
ethyl (E,4R)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5,5-dimethylhex-2-enoate (PubChem CID 86714739) has the molecular formula C14H19ClFN3O2 and a molecular weight of 315.78 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 86714739 |
| Molecular Formula | C14H19ClFN3O2 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl (E,4R)-4-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-5,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](Nc1nc(Cl)ncc1F)C(C)(C)C |
| InChI | InChI=1S/C14H19ClFN3O2/c1-5-21-11(20)7-6-10(14(2,3)4)18-12-9(16)8-17-13(15)19-12/h6-8,10H,5H2,1-4H3,(H,17,18,19)/b7-6+/t10-/m1/s1 |
| InChIKey | SFVRCIVRJPEJKS-VQCYPWCPSA-N |
| XLogP | 3.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|