About (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol
(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol (PubChem CID 86714752) has the molecular formula C10H15ClFN3S
and a molecular weight of 263.77 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol.
Molecular Properties
| Compound Name | (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol |
| PubChem CID | 86714752 |
| Molecular Formula | C10H15ClFN3S |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol |
| SMILES | CC(C)(C)[C@@H](CS)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H15ClFN3S/c1-10(2,3)7(5-16)14-8-6(12)4-13-9(11)15-8/h4,7,16H,5H2,1-3H3,(H,13,14,15)/t7-/m1/s1 |
| InChIKey | BOKGEBFFQFYPJZ-SSDOTTSWSA-N |
| XLogP | 3.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol?
The IUPAC name of (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol (CID 86714752) is (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol.
What is the SMILES notation for (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol?
The canonical SMILES for (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol is CC(C)(C)[C@@H](CS)Nc1nc(Cl)ncc1F.
What is the InChIKey of (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol?
The InChIKey is BOKGEBFFQFYPJZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H15ClFN3S/c1-10(2,3)7(5-16)14-8-6(12)4-13-9(11)15-8/h4,7,16H,5H2,1-3H3,(H,13,14,15)/t7-/m1/s1.
What are the key properties of (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol?
(2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol has a molecular weight of 263.77 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutane-1-thiol is sourced from PubChem (CID 86714752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).