C25H27ClN2O5 — CID 86714792
N-[(4-chlorophenyl)methyl]-2-[(1R,6R,10S,12R)-4,9-dioxo-6-phenyl-5,13-dioxa-8-azabicyclo[10.1.0]tridecan-10-yl]acetamide (PubChem CID 86714792) has the molecular formula C25H27ClN2O5 and a molecular weight of 470.95 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(1R,6R,10S,12R)-4,9-dioxo-6-phenyl-5,13-dioxa-8-azabicyclo[10.1.0]tridecan-10-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(1R,6R,10S,12R)-4,9-dioxo-6-phenyl-5,13-dioxa-8-azabicyclo[10.1.0]tridecan-10-yl]acetamide |
|---|---|
| PubChem CID | 86714792 |
| Molecular Formula | C25H27ClN2O5 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(1R,6R,10S,12R)-4,9-dioxo-6-phenyl-5,13-dioxa-8-azabicyclo[10.1.0]tridecan-10-yl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@H]2O[C@@H]2CCC(=O)O[C@H](c2ccccc2)CNC1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClN2O5/c26-19-8-6-16(7-9-19)14-27-23(29)13-18-12-21-20(32-21)10-11-24(30)33-22(15-28-25(18)31)17-4-2-1-3-5-17/h1-9,18,20-22H,10-15H2,(H,27,29)(H,28,31)/t18-,20+,21+,22-/m0/s1 |
| InChIKey | ZWIGCEKASRXWCU-PDGJWGCVSA-N |
| XLogP | 3.31 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|