C22H29ClN2O6 — CID 86714800
N-[(4-chlorophenyl)methyl]-2-[(3S,5S,6S,12S)-5,6-dihydroxy-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadecan-3-yl]acetamide (PubChem CID 86714800) has the molecular formula C22H29ClN2O6 and a molecular weight of 452.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(3S,5S,6S,12S)-5,6-dihydroxy-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadecan-3-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(3S,5S,6S,12S)-5,6-dihydroxy-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadecan-3-yl]acetamide |
|---|---|
| PubChem CID | 86714800 |
| Molecular Formula | C22H29ClN2O6 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(3S,5S,6S,12S)-5,6-dihydroxy-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadecan-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@H](O)[C@@H](O)CCC(=O)OC[C@@H]2CCCN2C1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN2O6/c23-16-5-3-14(4-6-16)12-24-20(28)11-15-10-19(27)18(26)7-8-21(29)31-13-17-2-1-9-25(17)22(15)30/h3-6,15,17-19,26-27H,1-2,7-13H2,(H,24,28)/t15-,17-,18-,19-/m0/s1 |
| InChIKey | SUOWFBDUHCRZDA-WNHJNPCNSA-N |
| XLogP | 1.40 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |