C18H23NO3 — CID 86714846
(3R,9E,12R)-12-methyl-3-phenyl-1-oxa-4-azacyclotridec-9-ene-5,13-dione (PubChem CID 86714846) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R,9E,12R)-12-methyl-3-phenyl-1-oxa-4-azacyclotridec-9-ene-5,13-dione.
| Compound Name | (3R,9E,12R)-12-methyl-3-phenyl-1-oxa-4-azacyclotridec-9-ene-5,13-dione |
|---|---|
| PubChem CID | 86714846 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (3R,9E,12R)-12-methyl-3-phenyl-1-oxa-4-azacyclotridec-9-ene-5,13-dione |
| SMILES | C[C@@H]1C/C=C/CCCC(=O)N[C@H](c2ccccc2)COC1=O |
| InChI | InChI=1S/C18H23NO3/c1-14-9-5-2-3-8-12-17(20)19-16(13-22-18(14)21)15-10-6-4-7-11-15/h2,4-7,10-11,14,16H,3,8-9,12-13H2,1H3,(H,19,20)/b5-2+/t14-,16+/m1/s1 |
| InChIKey | WRZYHHGBGRMJDU-MCQIKRLESA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|