C19H24N2O4 — CID 86714904
N-[(2R,3R,8E,11R)-2-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]acetamide (PubChem CID 86714904) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[(2R,3R,8E,11R)-2-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]acetamide.
| Compound Name | N-[(2R,3R,8E,11R)-2-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
|---|---|
| PubChem CID | 86714904 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[(2R,3R,8E,11R)-2-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C/C=C/CCC(=O)N[C@H](c2ccccc2)[C@@H](C)OC1=O |
| InChI | InChI=1S/C19H24N2O4/c1-13-18(15-9-5-3-6-10-15)21-17(23)12-8-4-7-11-16(19(24)25-13)20-14(2)22/h3-7,9-10,13,16,18H,8,11-12H2,1-2H3,(H,20,22)(H,21,23)/b7-4+/t13-,16-,18+/m1/s1 |
| InChIKey | XLSYQRLPGMNAFL-JCZOKPNYSA-N |
| XLogP | 2.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|