C22H28ClNO5 — CID 86714942
tert-butyl 2-[(3R,8E,11S)-3-(4-chlorophenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate (PubChem CID 86714942) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is tert-butyl 2-[(3R,8E,11S)-3-(4-chlorophenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,8E,11S)-3-(4-chlorophenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate |
|---|---|
| PubChem CID | 86714942 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | tert-butyl 2-[(3R,8E,11S)-3-(4-chlorophenyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C/C=C/CCC(=O)N[C@H](c2ccc(Cl)cc2)COC1=O |
| InChI | InChI=1S/C22H28ClNO5/c1-22(2,3)29-20(26)13-16-7-5-4-6-8-19(25)24-18(14-28-21(16)27)15-9-11-17(23)12-10-15/h4-5,9-12,16,18H,6-8,13-14H2,1-3H3,(H,24,25)/b5-4+/t16-,18-/m0/s1 |
| InChIKey | YNKYOYRMFFYVFY-NCWIEVAOSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|