C19H29NO5 — CID 86714969
tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate (PubChem CID 86714969) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
|---|---|
| PubChem CID | 86714969 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C/C=C/CCC(=O)OC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C19H29NO5/c1-19(2,3)25-17(22)12-14-8-5-4-6-10-16(21)24-13-15-9-7-11-20(15)18(14)23/h4-5,14-15H,6-13H2,1-3H3/b5-4+/t14-,15-/m0/s1 |
| InChIKey | SVGPQBQDEMPSPF-WFVIONGDSA-N |
| XLogP | 2.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|