C15H21NO5 — CID 86714970
2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid (PubChem CID 86714970) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid.
| Compound Name | 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid |
|---|---|
| PubChem CID | 86714970 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[(3S,5E,12S)-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C/C=C/CCC(=O)OC[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C15H21NO5/c17-13(18)9-11-5-2-1-3-7-14(19)21-10-12-6-4-8-16(12)15(11)20/h1-2,11-12H,3-10H2,(H,17,18)/b2-1+/t11-,12-/m0/s1 |
| InChIKey | YIVNEMVPKADVAL-NLMOASMRSA-N |
| XLogP | 1.35 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|