C16H23NO5 — CID 86714974
2-[(3S,5Z,8S,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid (PubChem CID 86714974) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[(3S,5Z,8S,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid.
| Compound Name | 2-[(3S,5Z,8S,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid |
|---|---|
| PubChem CID | 86714974 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[(3S,5Z,8S,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetic acid |
| SMILES | C[C@H]1C/C=C\C[C@@H](CC(=O)O)C(=O)N2CCC[C@H]2COC1=O |
| InChI | InChI=1S/C16H23NO5/c1-11-5-2-3-6-12(9-14(18)19)15(20)17-8-4-7-13(17)10-22-16(11)21/h2-3,11-13H,4-10H2,1H3,(H,18,19)/b3-2-/t11-,12-,13-/m0/s1 |
| InChIKey | PEDLWHWNLQLNDB-PJSBVKPWSA-N |
| XLogP | 1.60 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|