C20H31NO5 — CID 86714976
tert-butyl 2-[(3S,5E,8R,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate (PubChem CID 86714976) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl 2-[(3S,5E,8R,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,5E,8R,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
|---|---|
| PubChem CID | 86714976 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | tert-butyl 2-[(3S,5E,8R,12S)-8-methyl-2,9-dioxo-10-oxa-1-azabicyclo[10.3.0]pentadec-5-en-3-yl]acetate |
| SMILES | C[C@@H]1C/C=C/C[C@@H](CC(=O)OC(C)(C)C)C(=O)N2CCC[C@H]2COC1=O |
| InChI | InChI=1S/C20H31NO5/c1-14-8-5-6-9-15(12-17(22)26-20(2,3)4)18(23)21-11-7-10-16(21)13-25-19(14)24/h5-6,14-16H,7-13H2,1-4H3/b6-5+/t14-,15+,16+/m1/s1 |
| InChIKey | CUWLBSHHDUIUII-OMJOCJKRSA-N |
| XLogP | 2.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|