C11H22O3Si — CID 86714996
(2S)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enoic acid (PubChem CID 86714996) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enoic acid.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enoic acid |
|---|---|
| PubChem CID | 86714996 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enoic acid |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H22O3Si/c1-7-8-9(10(12)13)14-15(5,6)11(2,3)4/h7,9H,1,8H2,2-6H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | QWNQKVMYPNCZLC-VIFPVBQESA-N |
| XLogP | 3.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|