About tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate
tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate (PubChem CID 86715033) has the molecular formula C16H25NO5
and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate |
| PubChem CID | 86715033 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C/C=C/CCC(=O)OCCNC1=O |
| InChI | InChI=1S/C16H25NO5/c1-16(2,3)22-14(19)11-12-7-5-4-6-8-13(18)21-10-9-17-15(12)20/h4-5,12H,6-11H2,1-3H3,(H,17,20)/b5-4+/t12-/m0/s1 |
| InChIKey | VZLUEFHTKRZXDA-ITKZLYELSA-N |
| XLogP | 1.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate?
The IUPAC name of tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate (CID 86715033) is tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate.
What is the SMILES notation for tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate?
The canonical SMILES for tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate is CC(C)(C)OC(=O)C[C@@H]1C/C=C/CCC(=O)OCCNC1=O.
What is the InChIKey of tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate?
The InChIKey is VZLUEFHTKRZXDA-ITKZLYELSA-N. The full InChI is InChI=1S/C16H25NO5/c1-16(2,3)22-14(19)11-12-7-5-4-6-8-13(18)21-10-9-17-15(12)20/h4-5,12H,6-11H2,1-3H3,(H,17,20)/b5-4+/t12-/m0/s1.
What are the key properties of tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate?
tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate has a molecular weight of 311.38 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(6S,8E)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetate is sourced from PubChem (CID 86715033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).