C20H33NO5 — CID 86715056
tert-butyl 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate (PubChem CID 86715056) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate |
|---|---|
| PubChem CID | 86715056 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | tert-butyl 2-[(3R,8E,11S)-3-butyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetate |
| SMILES | CCCC[C@@H]1COC(=O)[C@H](CC(=O)OC(C)(C)C)C/C=C/CCC(=O)N1 |
| InChI | InChI=1S/C20H33NO5/c1-5-6-11-16-14-25-19(24)15(13-18(23)26-20(2,3)4)10-8-7-9-12-17(22)21-16/h7-8,15-16H,5-6,9-14H2,1-4H3,(H,21,22)/b8-7+/t15-,16+/m0/s1 |
| InChIKey | YQLWANASPOACBQ-APPUJDCNSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|