About [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate
[6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate (PubChem CID 86715270) has the molecular formula C9H12F2N2O4S
and a molecular weight of 282.27 g/mol. Its IUPAC name is [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate |
| PubChem CID | 86715270 |
| Molecular Formula | C9H12F2N2O4S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate |
| SMILES | COc1nnc(C(C)(F)F)cc1COS(C)(=O)=O |
| InChI | InChI=1S/C9H12F2N2O4S/c1-9(10,11)7-4-6(5-17-18(3,14)15)8(16-2)13-12-7/h4H,5H2,1-3H3 |
| InChIKey | OARAPJTVLVEWAR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate?
The IUPAC name of [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate (CID 86715270) is [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate.
What is the SMILES notation for [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate?
The canonical SMILES for [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate is COc1nnc(C(C)(F)F)cc1COS(C)(=O)=O.
What is the InChIKey of [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate?
The InChIKey is OARAPJTVLVEWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O4S/c1-9(10,11)7-4-6(5-17-18(3,14)15)8(16-2)13-12-7/h4H,5H2,1-3H3.
What are the key properties of [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate?
[6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate has a molecular weight of 282.27 g/mol, XLogP of 1.07, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,1-difluoroethyl)-3-methoxypyridazin-4-yl]methyl methanesulfonate is sourced from PubChem (CID 86715270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).