About ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate
ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate (PubChem CID 86715428) has the molecular formula C14H20O5
and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate.
Molecular Properties
| Compound Name | ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate |
| PubChem CID | 86715428 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate |
| SMILES | CCOC(=O)COC1C(C)=CC(C=O)=CC1(C)OC |
| InChI | InChI=1S/C14H20O5/c1-5-18-12(16)9-19-13-10(2)6-11(8-15)7-14(13,3)17-4/h6-8,13H,5,9H2,1-4H3 |
| InChIKey | UXYLPLKKYUFSAS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The IUPAC name of ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate (CID 86715428) is ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate.
What is the SMILES notation for ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The canonical SMILES for ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate is CCOC(=O)COC1C(C)=CC(C=O)=CC1(C)OC.
What is the InChIKey of ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The InChIKey is UXYLPLKKYUFSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-5-18-12(16)9-19-13-10(2)6-11(8-15)7-14(13,3)17-4/h6-8,13H,5,9H2,1-4H3.
What are the key properties of ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate?
ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate has a molecular weight of 268.31 g/mol, XLogP of 1.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-formyl-6-methoxy-2,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetate is sourced from PubChem (CID 86715428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).