About 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine
6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine (PubChem CID 86715626) has the molecular formula C23H22BrClN4
and a molecular weight of 469.81 g/mol. Its IUPAC name is 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine |
| PubChem CID | 86715626 |
| Molecular Formula | C23H22BrClN4 |
| Molecular Weight | 469.81 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine |
| SMILES | CCN(CC)c1nc2ccc(Br)cc2c(Cl)c1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C23H22BrClN4/c1-3-28(4-2)23-20(22(25)19-15-17(24)8-11-21(19)27-23)14-16-6-9-18(10-7-16)29-13-5-12-26-29/h5-13,15H,3-4,14H2,1-2H3 |
| InChIKey | FROXNWJUTZKQMQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine?
The IUPAC name of 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine (CID 86715626) is 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine.
What is the SMILES notation for 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine?
The canonical SMILES for 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine is CCN(CC)c1nc2ccc(Br)cc2c(Cl)c1Cc1ccc(-n2cccn2)cc1.
What is the InChIKey of 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine?
The InChIKey is FROXNWJUTZKQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22BrClN4/c1-3-28(4-2)23-20(22(25)19-15-17(24)8-11-21(19)27-23)14-16-6-9-18(10-7-16)29-13-5-12-26-29/h5-13,15H,3-4,14H2,1-2H3.
What are the key properties of 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine?
6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine has a molecular weight of 469.81 g/mol, XLogP of 6.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-chloro-N,N-diethyl-3-[(4-pyrazol-1-ylphenyl)methyl]quinolin-2-amine is sourced from PubChem (CID 86715626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).