C21H20BrClFN5O2S — CID 86715928
(3R)-3-[5-[(5-bromo-3-chloro-1,7-naphthyridin-8-yl)amino]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 86715928) has the molecular formula C21H20BrClFN5O2S and a molecular weight of 540.85 g/mol. Its IUPAC name is (3R)-3-[5-[(5-bromo-3-chloro-1,7-naphthyridin-8-yl)amino]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[5-[(5-bromo-3-chloro-1,7-naphthyridin-8-yl)amino]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 86715928 |
| Molecular Formula | C21H20BrClFN5O2S |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | (3R)-3-[5-[(5-bromo-3-chloro-1,7-naphthyridin-8-yl)amino]-2-fluorophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(C)C(N)=N[C@](C)(c2cc(Nc3ncc(Br)c4cc(Cl)cnc34)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C21H20BrClFN5O2S/c1-20(2)19(25)29-21(3,10-32(20,30)31)14-7-12(4-5-16(14)24)28-18-17-13(15(22)9-27-18)6-11(23)8-26-17/h4-9H,10H2,1-3H3,(H2,25,29)(H,27,28)/t21-/m0/s1 |
| InChIKey | GQRMAQJIJHVHCU-NRFANRHFSA-N |
| XLogP | 4.71 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |