About 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one
5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one (PubChem CID 86716047) has the molecular formula C13H19F2N3O
and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one |
| PubChem CID | 86716047 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(CN)N2CCC(F)(F)CC2)ccc1=O |
| InChI | InChI=1S/C13H19F2N3O/c1-17-9-10(2-3-12(17)19)11(8-16)18-6-4-13(14,15)5-7-18/h2-3,9,11H,4-8,16H2,1H3 |
| InChIKey | PDGFXXCLAPFNEP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one?
The IUPAC name of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one (CID 86716047) is 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one.
What is the SMILES notation for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one?
The canonical SMILES for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one is Cn1cc(C(CN)N2CCC(F)(F)CC2)ccc1=O.
What is the InChIKey of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one?
The InChIKey is PDGFXXCLAPFNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N3O/c1-17-9-10(2-3-12(17)19)11(8-16)18-6-4-13(14,15)5-7-18/h2-3,9,11H,4-8,16H2,1H3.
What are the key properties of 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one?
5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one has a molecular weight of 271.31 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-amino-1-(4,4-difluoropiperidin-1-yl)ethyl]-1-methylpyridin-2-one is sourced from PubChem (CID 86716047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).