About 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile
2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile (PubChem CID 86716205) has the molecular formula C13H13F2N3
and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile |
| PubChem CID | 86716205 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile |
| SMILES | Cc1ncc(C(C#N)=C2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C13H13F2N3/c1-9-17-7-11(8-18-9)12(6-16)10-2-4-13(14,15)5-3-10/h7-8H,2-5H2,1H3 |
| InChIKey | LRBKIKHNHHXLGG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile?
The IUPAC name of 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile (CID 86716205) is 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile.
What is the SMILES notation for 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile?
The canonical SMILES for 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile is Cc1ncc(C(C#N)=C2CCC(F)(F)CC2)cn1.
What is the InChIKey of 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile?
The InChIKey is LRBKIKHNHHXLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3/c1-9-17-7-11(8-18-9)12(6-16)10-2-4-13(14,15)5-3-10/h7-8H,2-5H2,1H3.
What are the key properties of 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile?
2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile has a molecular weight of 249.26 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexylidene)-2-(2-methylpyrimidin-5-yl)acetonitrile is sourced from PubChem (CID 86716205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).