C22H25ClN6O2 — CID 86716713
4-[1-[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]piperidin-4-yl]morpholine (PubChem CID 86716713) has the molecular formula C22H25ClN6O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is 4-[1-[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]piperidin-4-yl]morpholine.
| Compound Name | 4-[1-[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 86716713 |
| Molecular Formula | C22H25ClN6O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[1-[2-(2-chloro-4-pyridinyl)-5-methoxypyrido[3,4-d]pyrimidin-4-yl]piperidin-4-yl]morpholine |
| SMILES | COc1cncc2nc(-c3ccnc(Cl)c3)nc(N3CCC(N4CCOCC4)CC3)c12 |
| InChI | InChI=1S/C22H25ClN6O2/c1-30-18-14-24-13-17-20(18)22(27-21(26-17)15-2-5-25-19(23)12-15)29-6-3-16(4-7-29)28-8-10-31-11-9-28/h2,5,12-14,16H,3-4,6-11H2,1H3 |
| InChIKey | JYBSDQCEROLOBQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|