About 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one
1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one (PubChem CID 86716866) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 86716866 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one |
| SMILES | CCc1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21O |
| InChI | InChI=1S/C17H15NO4/c1-2-9-6-7-10-13(8-9)22-17(21)11-4-3-5-12(18)14(11)15(19)16(10,17)20/h3-8,20-21H,2,18H2,1H3 |
| InChIKey | WTIGGYFXOBONOT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one (CID 86716866) is 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one is CCc1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21O.
What is the InChIKey of 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
The InChIKey is WTIGGYFXOBONOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-2-9-6-7-10-13(8-9)22-17(21)11-4-3-5-12(18)14(11)15(19)16(10,17)20/h3-8,20-21H,2,18H2,1H3.
What are the key properties of 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one?
1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one has a molecular weight of 297.31 g/mol, XLogP of 1.45, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-7-ethyl-4b,9b-dihydroxyindeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 86716866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).