About 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one
9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one (PubChem CID 86716887) has the molecular formula C21H21ClO3
and a molecular weight of 356.85 g/mol. Its IUPAC name is 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 86716887 |
| Molecular Formula | C21H21ClO3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one |
| SMILES | CC(C)c1cc(C(C)C)c2c(c1)C1(Cl)C(=O)c3ccccc3C1(O)O2 |
| InChI | InChI=1S/C21H21ClO3/c1-11(2)13-9-15(12(3)4)18-17(10-13)20(22)19(23)14-7-5-6-8-16(14)21(20,24)25-18/h5-12,24H,1-4H3 |
| InChIKey | XVNMDULOHAFGHM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one (CID 86716887) is 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one is CC(C)c1cc(C(C)C)c2c(c1)C1(Cl)C(=O)c3ccccc3C1(O)O2.
What is the InChIKey of 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one?
The InChIKey is XVNMDULOHAFGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClO3/c1-11(2)13-9-15(12(3)4)18-17(10-13)20(22)19(23)14-7-5-6-8-16(14)21(20,24)25-18/h5-12,24H,1-4H3.
What are the key properties of 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one?
9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one has a molecular weight of 356.85 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-chloro-4b-hydroxy-6,8-di(propan-2-yl)indeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 86716887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).