About 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one
1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one (PubChem CID 86716900) has the molecular formula C18H15FO4
and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 86716900 |
| Molecular Formula | C18H15FO4 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(F)c3C(=O)C21O |
| InChI | InChI=1S/C18H15FO4/c1-9(2)10-6-7-11-14(8-10)23-18(22)12-4-3-5-13(19)15(12)16(20)17(11,18)21/h3-9,21-22H,1-2H3 |
| InChIKey | OWBGBJNBDRFJPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one (CID 86716900) is 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one is CC(C)c1ccc2c(c1)OC1(O)c3cccc(F)c3C(=O)C21O.
What is the InChIKey of 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
The InChIKey is OWBGBJNBDRFJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FO4/c1-9(2)10-6-7-11-14(8-10)23-18(22)12-4-3-5-13(19)15(12)16(20)17(11,18)21/h3-9,21-22H,1-2H3.
What are the key properties of 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one?
1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one has a molecular weight of 314.31 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4b,9b-dihydroxy-7-propan-2-ylindeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 86716900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).